C24H21N3O3 — CID 24884916
6-[2-(dimethylamino)ethyl]-9-hydroxy-4-phenylpyrrolo[3,4-c]carbazole-1,3-dione (PubChem CID 24884916) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 6-[2-(dimethylamino)ethyl]-9-hydroxy-4-phenylpyrrolo[3,4-c]carbazole-1,3-dione.
| Compound Name | 6-[2-(dimethylamino)ethyl]-9-hydroxy-4-phenylpyrrolo[3,4-c]carbazole-1,3-dione |
|---|---|
| PubChem CID | 24884916 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 6-[2-(dimethylamino)ethyl]-9-hydroxy-4-phenylpyrrolo[3,4-c]carbazole-1,3-dione |
| SMILES | CN(C)CCn1c2ccc(O)cc2c2c3c(c(-c4ccccc4)cc21)C(=O)NC3=O |
| InChI | InChI=1S/C24H21N3O3/c1-26(2)10-11-27-18-9-8-15(28)12-17(18)20-19(27)13-16(14-6-4-3-5-7-14)21-22(20)24(30)25-23(21)29/h3-9,12-13,28H,10-11H2,1-2H3,(H,25,29,30) |
| InChIKey | GKROVVTVYGBAEB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|