C40H66O5Si3 — CID 24885276
(3R)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S,6R)-6-[(2S)-2-triethylsilyloxy-4-(trimethylsilylmethyl)pent-4-enyl]oxan-2-yl]butanoic acid (PubChem CID 24885276) has the molecular formula C40H66O5Si3 and a molecular weight of 711.22 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S,6R)-6-[(2S)-2-triethylsilyloxy-4-(trimethylsilylmethyl)pent-4-enyl]oxan-2-yl]butanoic acid.
| Compound Name | (3R)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S,6R)-6-[(2S)-2-triethylsilyloxy-4-(trimethylsilylmethyl)pent-4-enyl]oxan-2-yl]butanoic acid |
|---|---|
| PubChem CID | 24885276 |
| Molecular Formula | C40H66O5Si3 |
| Molecular Weight | 711.22 g/mol |
| Exact Mass | 710.42 |
| IUPAC Name | (3R)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S,6R)-6-[(2S)-2-triethylsilyloxy-4-(trimethylsilylmethyl)pent-4-enyl]oxan-2-yl]butanoic acid |
| SMILES | C=C(C[C@@H](C[C@H]1CCC[C@@H](C[C@H](CC(=O)O)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1)O[Si](CC)(CC)CC)C[Si](C)(C)C |
| InChI | InChI=1S/C40H66O5Si3/c1-11-47(12-2,13-3)44-35(27-32(4)31-46(8,9)10)28-33-21-20-22-34(43-33)29-36(30-39(41)42)45-48(40(5,6)7,37-23-16-14-17-24-37)38-25-18-15-19-26-38/h14-19,23-26,33-36H,4,11-13,20-22,27-31H2,1-3,5-10H3,(H,41,42)/t33-,34+,35+,36-/m1/s1 |
| InChIKey | CPNJUNDMKHVWHL-FRMAJCGESA-N |
| XLogP | 9.80 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.22 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|