About 2,2-dimethylpropanoyl 4-propan-2-ylcyclohexane-1-carboxylate
2,2-dimethylpropanoyl 4-propan-2-ylcyclohexane-1-carboxylate (PubChem CID 24885300) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is 2,2-dimethylpropanoyl 4-propan-2-ylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 2,2-dimethylpropanoyl 4-propan-2-ylcyclohexane-1-carboxylate |
| PubChem CID | 24885300 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 2,2-dimethylpropanoyl 4-propan-2-ylcyclohexane-1-carboxylate |
| SMILES | CC(C)C1CCC(C(=O)OC(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H26O3/c1-10(2)11-6-8-12(9-7-11)13(16)18-14(17)15(3,4)5/h10-12H,6-9H2,1-5H3 |
| InChIKey | UOOAISBKWXZQRC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropanoyl 4-propan-2-ylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropanoyl 4-propan-2-ylcyclohexane-1-carboxylate?
The IUPAC name of 2,2-dimethylpropanoyl 4-propan-2-ylcyclohexane-1-carboxylate (CID 24885300) is 2,2-dimethylpropanoyl 4-propan-2-ylcyclohexane-1-carboxylate.
What is the SMILES notation for 2,2-dimethylpropanoyl 4-propan-2-ylcyclohexane-1-carboxylate?
The canonical SMILES for 2,2-dimethylpropanoyl 4-propan-2-ylcyclohexane-1-carboxylate is CC(C)C1CCC(C(=O)OC(=O)C(C)(C)C)CC1.
What is the InChIKey of 2,2-dimethylpropanoyl 4-propan-2-ylcyclohexane-1-carboxylate?
The InChIKey is UOOAISBKWXZQRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O3/c1-10(2)11-6-8-12(9-7-11)13(16)18-14(17)15(3,4)5/h10-12H,6-9H2,1-5H3.
What are the key properties of 2,2-dimethylpropanoyl 4-propan-2-ylcyclohexane-1-carboxylate?
2,2-dimethylpropanoyl 4-propan-2-ylcyclohexane-1-carboxylate has a molecular weight of 254.37 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropanoyl 4-propan-2-ylcyclohexane-1-carboxylate is sourced from PubChem (CID 24885300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).