C19H23F3N5O4PS — CID 24885544
2-[2-amino-6-(3-propoxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-(2,2,2-trifluoroethyl)phosphinic acid (PubChem CID 24885544) has the molecular formula C19H23F3N5O4PS and a molecular weight of 505.46 g/mol. Its IUPAC name is 2-[2-amino-6-(3-propoxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-(2,2,2-trifluoroethyl)phosphinic acid.
| Compound Name | 2-[2-amino-6-(3-propoxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-(2,2,2-trifluoroethyl)phosphinic acid |
|---|---|
| PubChem CID | 24885544 |
| Molecular Formula | C19H23F3N5O4PS |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | 2-[2-amino-6-(3-propoxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-(2,2,2-trifluoroethyl)phosphinic acid |
| SMILES | CCCOc1cccc(Sc2nc(N)nc3c2ncn3CCOCP(=O)(O)CC(F)(F)F)c1 |
| InChI | InChI=1S/C19H23F3N5O4PS/c1-2-7-31-13-4-3-5-14(9-13)33-17-15-16(25-18(23)26-17)27(11-24-15)6-8-30-12-32(28,29)10-19(20,21)22/h3-5,9,11H,2,6-8,10,12H2,1H3,(H,28,29)(H2,23,25,26) |
| InChIKey | WBELDPOKYUHZKR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|