C20H18F3N3O3S — CID 2488599
N-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]-N-prop-2-enyl-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 2488599) has the molecular formula C20H18F3N3O3S and a molecular weight of 437.44 g/mol. Its IUPAC name is N-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]-N-prop-2-enyl-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]-N-prop-2-enyl-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2488599 |
| Molecular Formula | C20H18F3N3O3S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]-N-prop-2-enyl-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | C=CCN(Cc1cc(=O)n2cc(C)ccc2n1)S(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H18F3N3O3S/c1-3-10-25(30(28,29)17-7-5-4-6-16(17)20(21,22)23)13-15-11-19(27)26-12-14(2)8-9-18(26)24-15/h3-9,11-12H,1,10,13H2,2H3 |
| InChIKey | OOFPOEIAGUOUGG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|