C24H14F5NO2 — CID 24886637
[[(1E,4E)-1,5-diphenylpenta-1,4-dien-3-ylidene]amino] 2,3,4,5,6-pentafluorobenzoate (PubChem CID 24886637) has the molecular formula C24H14F5NO2 and a molecular weight of 443.37 g/mol. Its IUPAC name is [[(1E,4E)-1,5-diphenylpenta-1,4-dien-3-ylidene]amino] 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [[(1E,4E)-1,5-diphenylpenta-1,4-dien-3-ylidene]amino] 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 24886637 |
| Molecular Formula | C24H14F5NO2 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | [[(1E,4E)-1,5-diphenylpenta-1,4-dien-3-ylidene]amino] 2,3,4,5,6-pentafluorobenzoate |
| SMILES | O=C(ON=C(/C=C/c1ccccc1)/C=C/c1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H14F5NO2/c25-19-18(20(26)22(28)23(29)21(19)27)24(31)32-30-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-14H/b13-11+,14-12+ |
| InChIKey | ALPMOPISHKLNGB-PHEQNACWSA-N |
| XLogP | 6.32 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|