C19H27NO11 — CID 24886644
methyl (2R,3R,6S)-3-acetamido-6-methoxy-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,3-dihydropyran-6-carboxylate (PubChem CID 24886644) has the molecular formula C19H27NO11 and a molecular weight of 445.42 g/mol. Its IUPAC name is methyl (2R,3R,6S)-3-acetamido-6-methoxy-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,3-dihydropyran-6-carboxylate.
| Compound Name | methyl (2R,3R,6S)-3-acetamido-6-methoxy-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,3-dihydropyran-6-carboxylate |
|---|---|
| PubChem CID | 24886644 |
| Molecular Formula | C19H27NO11 |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | methyl (2R,3R,6S)-3-acetamido-6-methoxy-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,3-dihydropyran-6-carboxylate |
| SMILES | COC(=O)[C@]1(OC)C=C[C@@H](NC(C)=O)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C19H27NO11/c1-10(21)20-14-7-8-19(27-6,18(25)26-5)31-16(14)17(30-13(4)24)15(29-12(3)23)9-28-11(2)22/h7-8,14-17H,9H2,1-6H3,(H,20,21)/t14-,15-,16-,17-,19+/m1/s1 |
| InChIKey | MCYBRPURZJNDEP-VDCDIQELSA-N |
| XLogP | -0.61 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|