C35H42N2 — CID 24886857
1,3-bis[2,7-di(propan-2-yl)naphthalen-1-yl]-4,5-dihydro-2H-imidazol-1-ium-2-ide (PubChem CID 24886857) has the molecular formula C35H42N2 and a molecular weight of 490.74 g/mol. Its IUPAC name is 1,3-bis[2,7-di(propan-2-yl)naphthalen-1-yl]-4,5-dihydro-2H-imidazol-1-ium-2-ide.
| Compound Name | 1,3-bis[2,7-di(propan-2-yl)naphthalen-1-yl]-4,5-dihydro-2H-imidazol-1-ium-2-ide |
|---|---|
| PubChem CID | 24886857 |
| Molecular Formula | C35H42N2 |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | 1,3-bis[2,7-di(propan-2-yl)naphthalen-1-yl]-4,5-dihydro-2H-imidazol-1-ium-2-ide |
| SMILES | CC(C)c1ccc2ccc(C(C)C)c(N3[C-]=[N+](c4c(C(C)C)ccc5ccc(C(C)C)cc45)CC3)c2c1 |
| InChI | InChI=1S/C35H42N2/c1-22(2)28-11-9-26-13-15-30(24(5)6)34(32(26)19-28)36-17-18-37(21-36)35-31(25(7)8)16-14-27-10-12-29(23(3)4)20-33(27)35/h9-16,19-20,22-25H,17-18H2,1-8H3 |
| InChIKey | ZVOMOJYSNJJLFO-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|