C17H19F3N5O4PS — CID 24886969
2-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-(2,2,2-trifluoroethyl)phosphinic acid (PubChem CID 24886969) has the molecular formula C17H19F3N5O4PS and a molecular weight of 477.41 g/mol. Its IUPAC name is 2-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-(2,2,2-trifluoroethyl)phosphinic acid.
| Compound Name | 2-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-(2,2,2-trifluoroethyl)phosphinic acid |
|---|---|
| PubChem CID | 24886969 |
| Molecular Formula | C17H19F3N5O4PS |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 2-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-(2,2,2-trifluoroethyl)phosphinic acid |
| SMILES | COc1ccc(Sc2nc(N)nc3c2ncn3CCOCP(=O)(O)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3N5O4PS/c1-28-11-2-4-12(5-3-11)31-15-13-14(23-16(21)24-15)25(9-22-13)6-7-29-10-30(26,27)8-17(18,19)20/h2-5,9H,6-8,10H2,1H3,(H,26,27)(H2,21,23,24) |
| InChIKey | WZHCVYZHNGZGTI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|