About bis(4-fluorophenyl)-(1,3-oxazol-2-yl)methanesulfinamide
bis(4-fluorophenyl)-(1,3-oxazol-2-yl)methanesulfinamide (PubChem CID 24886987) has the molecular formula C16H12F2N2O2S
and a molecular weight of 334.35 g/mol. Its IUPAC name is bis(4-fluorophenyl)-(1,3-oxazol-2-yl)methanesulfinamide.
Molecular Properties
| Compound Name | bis(4-fluorophenyl)-(1,3-oxazol-2-yl)methanesulfinamide |
| PubChem CID | 24886987 |
| Molecular Formula | C16H12F2N2O2S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | bis(4-fluorophenyl)-(1,3-oxazol-2-yl)methanesulfinamide |
| SMILES | NS(=O)C(c1ccc(F)cc1)(c1ccc(F)cc1)c1ncco1 |
| InChI | InChI=1S/C16H12F2N2O2S/c17-13-5-1-11(2-6-13)16(23(19)21,15-20-9-10-22-15)12-3-7-14(18)8-4-12/h1-10H,19H2 |
| InChIKey | OPCFCJABCFAPRJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(4-fluorophenyl)-(1,3-oxazol-2-yl)methanesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-fluorophenyl)-(1,3-oxazol-2-yl)methanesulfinamide?
The IUPAC name of bis(4-fluorophenyl)-(1,3-oxazol-2-yl)methanesulfinamide (CID 24886987) is bis(4-fluorophenyl)-(1,3-oxazol-2-yl)methanesulfinamide.
What is the SMILES notation for bis(4-fluorophenyl)-(1,3-oxazol-2-yl)methanesulfinamide?
The canonical SMILES for bis(4-fluorophenyl)-(1,3-oxazol-2-yl)methanesulfinamide is NS(=O)C(c1ccc(F)cc1)(c1ccc(F)cc1)c1ncco1.
What is the InChIKey of bis(4-fluorophenyl)-(1,3-oxazol-2-yl)methanesulfinamide?
The InChIKey is OPCFCJABCFAPRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F2N2O2S/c17-13-5-1-11(2-6-13)16(23(19)21,15-20-9-10-22-15)12-3-7-14(18)8-4-12/h1-10H,19H2.
What are the key properties of bis(4-fluorophenyl)-(1,3-oxazol-2-yl)methanesulfinamide?
bis(4-fluorophenyl)-(1,3-oxazol-2-yl)methanesulfinamide has a molecular weight of 334.35 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-fluorophenyl)-(1,3-oxazol-2-yl)methanesulfinamide is sourced from PubChem (CID 24886987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).