About 1-benzyl-4-butyltriazole
1-benzyl-4-butyltriazole (PubChem CID 24887144) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol. Its IUPAC name is 1-benzyl-4-butyltriazole.
Molecular Properties
| Compound Name | 1-benzyl-4-butyltriazole |
| PubChem CID | 24887144 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 1-benzyl-4-butyltriazole |
| SMILES | CCCCc1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C13H17N3/c1-2-3-9-13-11-16(15-14-13)10-12-7-5-4-6-8-12/h4-8,11H,2-3,9-10H2,1H3 |
| InChIKey | ZEUSJLRLKGNXLV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-4-butyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-butyltriazole?
The IUPAC name of 1-benzyl-4-butyltriazole (CID 24887144) is 1-benzyl-4-butyltriazole.
What is the SMILES notation for 1-benzyl-4-butyltriazole?
The canonical SMILES for 1-benzyl-4-butyltriazole is CCCCc1cn(Cc2ccccc2)nn1.
What is the InChIKey of 1-benzyl-4-butyltriazole?
The InChIKey is ZEUSJLRLKGNXLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3/c1-2-3-9-13-11-16(15-14-13)10-12-7-5-4-6-8-12/h4-8,11H,2-3,9-10H2,1H3.
What are the key properties of 1-benzyl-4-butyltriazole?
1-benzyl-4-butyltriazole has a molecular weight of 215.30 g/mol, XLogP of 2.67, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-butyltriazole is sourced from PubChem (CID 24887144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).