C30H29FeNO4+2 — CID 24887156
CID 24887156 (PubChem CID 24887156) has the molecular formula C30H29FeNO4+2 and a molecular weight of 523.41 g/mol.
| Compound Name | CID 24887156 |
|---|---|
| PubChem CID | 24887156 |
| Molecular Formula | C30H29FeNO4+2 |
| Molecular Weight | 523.41 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | — |
| SMILES | C[C@H](C(=O)N1C(=O)O[C@@H]([C]2[CH][CH][CH][CH]2)[C@H]1Cc1ccccc1)[C@@H](O)c1ccccc1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C25H24NO4.C5H5.Fe/c1-17(22(27)19-12-6-3-7-13-19)24(28)26-21(16-18-10-4-2-5-11-18)23(30-25(26)29)20-14-8-9-15-20;1-2-4-5-3-1;/h2-15,17,21-23,27H,16H2,1H3;1-5H;/q;;+2/t17-,21+,22+,23-;;/m0../s1 |
| InChIKey | MTZDAUCSCNTXBL-ZTCYHRLJSA-N |
| XLogP | 4.74 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|