C18H16N2O — CID 24887406
5-(1H-indol-5-yl)-1,2,4,5-tetrahydro-2-benzazepin-3-one (PubChem CID 24887406) has the molecular formula C18H16N2O and a molecular weight of 276.34 g/mol. Its IUPAC name is 5-(1H-indol-5-yl)-1,2,4,5-tetrahydro-2-benzazepin-3-one.
| Compound Name | 5-(1H-indol-5-yl)-1,2,4,5-tetrahydro-2-benzazepin-3-one |
|---|---|
| PubChem CID | 24887406 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 5-(1H-indol-5-yl)-1,2,4,5-tetrahydro-2-benzazepin-3-one |
| SMILES | O=C1CC(c2ccc3[nH]ccc3c2)c2ccccc2CN1 |
| InChI | InChI=1S/C18H16N2O/c21-18-10-16(15-4-2-1-3-14(15)11-20-18)12-5-6-17-13(9-12)7-8-19-17/h1-9,16,19H,10-11H2,(H,20,21) |
| InChIKey | KQJNXPOOAZKGPM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |