C26H24N4O2 — CID 24887862
4-benzyl-2,15-dimethyl-2,4,13,15-tetrazapentacyclo[11.8.0.01,5.06,11.016,21]henicosa-6,8,10,16,18,20-hexaene-3,14-dione (PubChem CID 24887862) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 4-benzyl-2,15-dimethyl-2,4,13,15-tetrazapentacyclo[11.8.0.01,5.06,11.016,21]henicosa-6,8,10,16,18,20-hexaene-3,14-dione.
| Compound Name | 4-benzyl-2,15-dimethyl-2,4,13,15-tetrazapentacyclo[11.8.0.01,5.06,11.016,21]henicosa-6,8,10,16,18,20-hexaene-3,14-dione |
|---|---|
| PubChem CID | 24887862 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 4-benzyl-2,15-dimethyl-2,4,13,15-tetrazapentacyclo[11.8.0.01,5.06,11.016,21]henicosa-6,8,10,16,18,20-hexaene-3,14-dione |
| SMILES | CN1C(=O)N2Cc3ccccc3C3N(Cc4ccccc4)C(=O)N(C)C32c2ccccc21 |
| InChI | InChI=1S/C26H24N4O2/c1-27-22-15-9-8-14-21(22)26-23(20-13-7-6-12-19(20)17-30(26)24(27)31)29(25(32)28(26)2)16-18-10-4-3-5-11-18/h3-15,23H,16-17H2,1-2H3 |
| InChIKey | TWZTUIRAEUYRQZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |