C24H26N4O2 — CID 24888042
4-cyclopentyl-15-[(3R)-3-methoxypyrrolidin-1-yl]-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one (PubChem CID 24888042) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 4-cyclopentyl-15-[(3R)-3-methoxypyrrolidin-1-yl]-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one.
| Compound Name | 4-cyclopentyl-15-[(3R)-3-methoxypyrrolidin-1-yl]-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
|---|---|
| PubChem CID | 24888042 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 4-cyclopentyl-15-[(3R)-3-methoxypyrrolidin-1-yl]-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
| SMILES | CO[C@@H]1CCN(c2ccc3c(c2)c2c(=O)[nH]ccc2c2nc(C4CCCC4)[nH]c32)C1 |
| InChI | InChI=1S/C24H26N4O2/c1-30-16-9-11-28(13-16)15-6-7-17-19(12-15)20-18(8-10-25-24(20)29)22-21(17)26-23(27-22)14-4-2-3-5-14/h6-8,10,12,14,16H,2-5,9,11,13H2,1H3,(H,25,29)(H,26,27)/t16-/m1/s1 |
| InChIKey | KZXYDMVDSSUDOJ-MRXNPFEDSA-N |
| XLogP | 4.44 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|