About tert-butyl N-[(2R,3R)-1-hydroxy-3-(methoxymethoxy)pent-4-en-2-yl]carbamate
tert-butyl N-[(2R,3R)-1-hydroxy-3-(methoxymethoxy)pent-4-en-2-yl]carbamate (PubChem CID 24888051) has the molecular formula C12H23NO5
and a molecular weight of 261.32 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-1-hydroxy-3-(methoxymethoxy)pent-4-en-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2R,3R)-1-hydroxy-3-(methoxymethoxy)pent-4-en-2-yl]carbamate |
| PubChem CID | 24888051 |
| Molecular Formula | C12H23NO5 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | tert-butyl N-[(2R,3R)-1-hydroxy-3-(methoxymethoxy)pent-4-en-2-yl]carbamate |
| SMILES | C=C[C@@H](OCOC)[C@@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23NO5/c1-6-10(17-8-16-5)9(7-14)13-11(15)18-12(2,3)4/h6,9-10,14H,1,7-8H2,2-5H3,(H,13,15)/t9-,10-/m1/s1 |
| InChIKey | NCVXREWZTNCAEI-NXEZZACHSA-N |
| XLogP | 1.05 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(2R,3R)-1-hydroxy-3-(methoxymethoxy)pent-4-en-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2R,3R)-1-hydroxy-3-(methoxymethoxy)pent-4-en-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(2R,3R)-1-hydroxy-3-(methoxymethoxy)pent-4-en-2-yl]carbamate (CID 24888051) is tert-butyl N-[(2R,3R)-1-hydroxy-3-(methoxymethoxy)pent-4-en-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(2R,3R)-1-hydroxy-3-(methoxymethoxy)pent-4-en-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(2R,3R)-1-hydroxy-3-(methoxymethoxy)pent-4-en-2-yl]carbamate is C=C[C@@H](OCOC)[C@@H](CO)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2R,3R)-1-hydroxy-3-(methoxymethoxy)pent-4-en-2-yl]carbamate?
The InChIKey is NCVXREWZTNCAEI-NXEZZACHSA-N. The full InChI is InChI=1S/C12H23NO5/c1-6-10(17-8-16-5)9(7-14)13-11(15)18-12(2,3)4/h6,9-10,14H,1,7-8H2,2-5H3,(H,13,15)/t9-,10-/m1/s1.
What are the key properties of tert-butyl N-[(2R,3R)-1-hydroxy-3-(methoxymethoxy)pent-4-en-2-yl]carbamate?
tert-butyl N-[(2R,3R)-1-hydroxy-3-(methoxymethoxy)pent-4-en-2-yl]carbamate has a molecular weight of 261.32 g/mol, XLogP of 1.05, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2R,3R)-1-hydroxy-3-(methoxymethoxy)pent-4-en-2-yl]carbamate is sourced from PubChem (CID 24888051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).