C24H26N8OS — CID 24888611
4-[8-[4-[4-(cyclopropylmethyl)piperazin-1-yl]anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]thiophene-2-carboxamide (PubChem CID 24888611) has the molecular formula C24H26N8OS and a molecular weight of 474.59 g/mol. Its IUPAC name is 4-[8-[4-[4-(cyclopropylmethyl)piperazin-1-yl]anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]thiophene-2-carboxamide.
| Compound Name | 4-[8-[4-[4-(cyclopropylmethyl)piperazin-1-yl]anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24888611 |
| Molecular Formula | C24H26N8OS |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 4-[8-[4-[4-(cyclopropylmethyl)piperazin-1-yl]anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]thiophene-2-carboxamide |
| SMILES | NC(=O)c1cc(-c2cnc(Nc3ccc(N4CCN(CC5CC5)CC4)cc3)c3ncnn23)cs1 |
| InChI | InChI=1S/C24H26N8OS/c25-22(33)21-11-17(14-34-21)20-12-26-23(24-27-15-28-32(20)24)29-18-3-5-19(6-4-18)31-9-7-30(8-10-31)13-16-1-2-16/h3-6,11-12,14-16H,1-2,7-10,13H2,(H2,25,33)(H,26,29) |
| InChIKey | CEQGCMHVEDNLEF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|