C22H21F3N8OS — CID 24888612
4-[8-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]thiophene-2-carboxamide (PubChem CID 24888612) has the molecular formula C22H21F3N8OS and a molecular weight of 502.53 g/mol. Its IUPAC name is 4-[8-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]thiophene-2-carboxamide.
| Compound Name | 4-[8-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24888612 |
| Molecular Formula | C22H21F3N8OS |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 4-[8-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]thiophene-2-carboxamide |
| SMILES | NC(=O)c1cc(-c2cnc(Nc3ccc(N4CCN(CC(F)(F)F)CC4)cc3)c3ncnn23)cs1 |
| InChI | InChI=1S/C22H21F3N8OS/c23-22(24,25)12-31-5-7-32(8-6-31)16-3-1-15(2-4-16)30-20-21-28-13-29-33(21)17(10-27-20)14-9-18(19(26)34)35-11-14/h1-4,9-11,13H,5-8,12H2,(H2,26,34)(H,27,30) |
| InChIKey | SFFPRZBXKZPBER-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|