C25H26N4O3 — CID 24888717
4-cyclopentyl-15-(4-hydroxypiperidine-1-carbonyl)-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one (PubChem CID 24888717) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 4-cyclopentyl-15-(4-hydroxypiperidine-1-carbonyl)-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one.
| Compound Name | 4-cyclopentyl-15-(4-hydroxypiperidine-1-carbonyl)-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
|---|---|
| PubChem CID | 24888717 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 4-cyclopentyl-15-(4-hydroxypiperidine-1-carbonyl)-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
| SMILES | O=C(c1ccc2c(c1)c1c(=O)[nH]ccc1c1nc(C3CCCC3)[nH]c21)N1CCC(O)CC1 |
| InChI | InChI=1S/C25H26N4O3/c30-16-8-11-29(12-9-16)25(32)15-5-6-17-19(13-15)20-18(7-10-26-24(20)31)22-21(17)27-23(28-22)14-3-1-2-4-14/h5-7,10,13-14,16,30H,1-4,8-9,11-12H2,(H,26,31)(H,27,28) |
| InChIKey | LYTPWVCVRYOXAX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|