C23H25N3O — CID 24889034
(3E)-8-methyl-3-(1-methylpyrrolidin-2-ylidene)-5-phenyl-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-2-one (PubChem CID 24889034) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is (3E)-8-methyl-3-(1-methylpyrrolidin-2-ylidene)-5-phenyl-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-2-one.
| Compound Name | (3E)-8-methyl-3-(1-methylpyrrolidin-2-ylidene)-5-phenyl-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-2-one |
|---|---|
| PubChem CID | 24889034 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (3E)-8-methyl-3-(1-methylpyrrolidin-2-ylidene)-5-phenyl-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-2-one |
| SMILES | CN1CCc2c(-c3ccccc3)cc3c(c2C1)NC(=O)/C3=C1\CCCN1C |
| InChI | InChI=1S/C23H25N3O/c1-25-12-10-16-17(15-7-4-3-5-8-15)13-18-21(20-9-6-11-26(20)2)23(27)24-22(18)19(16)14-25/h3-5,7-8,13H,6,9-12,14H2,1-2H3,(H,24,27)/b21-20+ |
| InChIKey | UVIZTMPLBFUZQV-QZQOTICOSA-N |
| XLogP | 3.73 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|