C27H33NO4Si — CID 24889144
ethyl (1S,5R,6S)-7-acetyl-5-[tert-butyl(diphenyl)silyl]oxy-7-azabicyclo[4.1.0]hept-2-ene-3-carboxylate (PubChem CID 24889144) has the molecular formula C27H33NO4Si and a molecular weight of 463.65 g/mol. Its IUPAC name is ethyl (1S,5R,6S)-7-acetyl-5-[tert-butyl(diphenyl)silyl]oxy-7-azabicyclo[4.1.0]hept-2-ene-3-carboxylate.
| Compound Name | ethyl (1S,5R,6S)-7-acetyl-5-[tert-butyl(diphenyl)silyl]oxy-7-azabicyclo[4.1.0]hept-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 24889144 |
| Molecular Formula | C27H33NO4Si |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | ethyl (1S,5R,6S)-7-acetyl-5-[tert-butyl(diphenyl)silyl]oxy-7-azabicyclo[4.1.0]hept-2-ene-3-carboxylate |
| SMILES | CCOC(=O)C1=C[C@H]2[C@@H]([C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C1)N2C(C)=O |
| InChI | InChI=1S/C27H33NO4Si/c1-6-31-26(30)20-17-23-25(28(23)19(2)29)24(18-20)32-33(27(3,4)5,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-17,23-25H,6,18H2,1-5H3/t23-,24+,25-,28?/m0/s1 |
| InChIKey | FCAAUZYBENPNPU-MXKRKJNMSA-N |
| XLogP | 3.42 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|