C23H20N4O4S — CID 24889189
5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]imidazolidine-2,4-dione (PubChem CID 24889189) has the molecular formula C23H20N4O4S and a molecular weight of 448.50 g/mol. Its IUPAC name is 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24889189 |
| Molecular Formula | C23H20N4O4S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(CC1(c3ccc(-c4csc(C)n4)cc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C23H20N4O4S/c1-13-24-19(11-32-13)14-3-6-16(7-4-14)23(21(29)25-22(30)26-23)12-27-10-15-5-8-17(31-2)9-18(15)20(27)28/h3-9,11H,10,12H2,1-2H3,(H2,25,26,29,30) |
| InChIKey | FAMQSXIDMNSKRT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|