C26H26F7NO3 — CID 24889285
(1S,2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-6-hydroxy-7,7-dimethyl-1,2,3,6,8,8a-hexahydroindolizin-5-one (PubChem CID 24889285) has the molecular formula C26H26F7NO3 and a molecular weight of 533.48 g/mol. Its IUPAC name is (1S,2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-6-hydroxy-7,7-dimethyl-1,2,3,6,8,8a-hexahydroindolizin-5-one.
| Compound Name | (1S,2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-6-hydroxy-7,7-dimethyl-1,2,3,6,8,8a-hexahydroindolizin-5-one |
|---|---|
| PubChem CID | 24889285 |
| Molecular Formula | C26H26F7NO3 |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | (1S,2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-6-hydroxy-7,7-dimethyl-1,2,3,6,8,8a-hexahydroindolizin-5-one |
| SMILES | C[C@@H](O[C@H]1CN2C(=O)C(O)C(C)(C)CC2[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H26F7NO3/c1-13(15-8-16(25(28,29)30)10-17(9-15)26(31,32)33)37-20-12-34-19(11-24(2,3)22(35)23(34)36)21(20)14-4-6-18(27)7-5-14/h4-10,13,19-22,35H,11-12H2,1-3H3/t13-,19?,20+,21+,22?/m1/s1 |
| InChIKey | ISEJRLNMAUJZHG-KWPMZGPOSA-N |
| XLogP | 6.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |