C19H24N4O5 — CID 24889491
benzyl (2R)-2-[3-(ethoxycarbonylamino)propanoylamino]-3-(1H-imidazol-5-yl)propanoate (PubChem CID 24889491) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is benzyl (2R)-2-[3-(ethoxycarbonylamino)propanoylamino]-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | benzyl (2R)-2-[3-(ethoxycarbonylamino)propanoylamino]-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 24889491 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | benzyl (2R)-2-[3-(ethoxycarbonylamino)propanoylamino]-3-(1H-imidazol-5-yl)propanoate |
| SMILES | CCOC(=O)NCCC(=O)N[C@H](Cc1cnc[nH]1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H24N4O5/c1-2-27-19(26)21-9-8-17(24)23-16(10-15-11-20-13-22-15)18(25)28-12-14-6-4-3-5-7-14/h3-7,11,13,16H,2,8-10,12H2,1H3,(H,20,22)(H,21,26)(H,23,24)/t16-/m1/s1 |
| InChIKey | VTNVKILBCCGSJD-MRXNPFEDSA-N |
| XLogP | 1.32 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |