C15H21N5O2S — CID 2488962
4-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-1-morpholin-4-ylbutan-1-one (PubChem CID 2488962) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 4-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-1-morpholin-4-ylbutan-1-one.
| Compound Name | 4-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-1-morpholin-4-ylbutan-1-one |
|---|---|
| PubChem CID | 2488962 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 4-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-1-morpholin-4-ylbutan-1-one |
| SMILES | Cc1cc(C)n2nc(SCCCC(=O)N3CCOCC3)nc2n1 |
| InChI | InChI=1S/C15H21N5O2S/c1-11-10-12(2)20-14(16-11)17-15(18-20)23-9-3-4-13(21)19-5-7-22-8-6-19/h10H,3-9H2,1-2H3 |
| InChIKey | WQBQEHDNHHKFAY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|