C21H15FN4O3S — CID 24889862
5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]-5-(5-pyridin-2-ylthiophen-2-yl)imidazolidine-2,4-dione (PubChem CID 24889862) has the molecular formula C21H15FN4O3S and a molecular weight of 422.44 g/mol. Its IUPAC name is 5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]-5-(5-pyridin-2-ylthiophen-2-yl)imidazolidine-2,4-dione.
| Compound Name | 5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]-5-(5-pyridin-2-ylthiophen-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24889862 |
| Molecular Formula | C21H15FN4O3S |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]-5-(5-pyridin-2-ylthiophen-2-yl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CN2Cc3ccc(F)cc3C2=O)(c2ccc(-c3ccccn3)s2)N1 |
| InChI | InChI=1S/C21H15FN4O3S/c22-13-5-4-12-10-26(18(27)14(12)9-13)11-21(19(28)24-20(29)25-21)17-7-6-16(30-17)15-3-1-2-8-23-15/h1-9H,10-11H2,(H2,24,25,28,29) |
| InChIKey | IIORFJOWBIPBSI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|