C24H31F3N4O3 — CID 24890071
4-[3,3-dimethyl-2-oxo-4-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]pyrrolidin-1-yl]-N'-hydroxyadamantane-1-carboximidamide (PubChem CID 24890071) has the molecular formula C24H31F3N4O3 and a molecular weight of 480.53 g/mol. Its IUPAC name is 4-[3,3-dimethyl-2-oxo-4-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]pyrrolidin-1-yl]-N'-hydroxyadamantane-1-carboximidamide.
| Compound Name | 4-[3,3-dimethyl-2-oxo-4-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]pyrrolidin-1-yl]-N'-hydroxyadamantane-1-carboximidamide |
|---|---|
| PubChem CID | 24890071 |
| Molecular Formula | C24H31F3N4O3 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 4-[3,3-dimethyl-2-oxo-4-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]pyrrolidin-1-yl]-N'-hydroxyadamantane-1-carboximidamide |
| SMILES | CC1(C)C(=O)N(C2C3CC4CC2CC(/C(N)=N\O)(C4)C3)CC1COc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C24H31F3N4O3/c1-22(2)17(12-34-18-4-3-16(10-29-18)24(25,26)27)11-31(21(22)32)19-14-5-13-6-15(19)9-23(7-13,8-14)20(28)30-33/h3-4,10,13-15,17,19,33H,5-9,11-12H2,1-2H3,(H2,28,30) |
| InChIKey | UZCSLSQPVOHMEK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|