C17H16BrN3 — CID 24890227
8-amino-5-(4-bromophenyl)-2-methyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile (PubChem CID 24890227) has the molecular formula C17H16BrN3 and a molecular weight of 342.24 g/mol. Its IUPAC name is 8-amino-5-(4-bromophenyl)-2-methyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile.
| Compound Name | 8-amino-5-(4-bromophenyl)-2-methyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 24890227 |
| Molecular Formula | C17H16BrN3 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 8-amino-5-(4-bromophenyl)-2-methyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile |
| SMILES | CN1CCc2c(-c3ccc(Br)cc3)cc(C#N)c(N)c2C1 |
| InChI | InChI=1S/C17H16BrN3/c1-21-7-6-14-15(11-2-4-13(18)5-3-11)8-12(9-19)17(20)16(14)10-21/h2-5,8H,6-7,10,20H2,1H3 |
| InChIKey | BZHPYBQIJYIEJJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|