About 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1R)-1-phenylethyl]ethanimine
1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1R)-1-phenylethyl]ethanimine (PubChem CID 24890559) has the molecular formula C18H15F6N
and a molecular weight of 359.31 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1R)-1-phenylethyl]ethanimine.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1R)-1-phenylethyl]ethanimine |
| PubChem CID | 24890559 |
| Molecular Formula | C18H15F6N |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1R)-1-phenylethyl]ethanimine |
| SMILES | C/C(=N\[C@H](C)c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F6N/c1-11(13-6-4-3-5-7-13)25-12(2)14-8-15(17(19,20)21)10-16(9-14)18(22,23)24/h3-11H,1-2H3/b25-12+/t11-/m1/s1 |
| InChIKey | HAUDLOVNWUELPH-AZFWPXOISA-N |
| XLogP | 6.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1R)-1-phenylethyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1R)-1-phenylethyl]ethanimine?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1R)-1-phenylethyl]ethanimine (CID 24890559) is 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1R)-1-phenylethyl]ethanimine.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1R)-1-phenylethyl]ethanimine?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1R)-1-phenylethyl]ethanimine is C/C(=N\[C@H](C)c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1R)-1-phenylethyl]ethanimine?
The InChIKey is HAUDLOVNWUELPH-AZFWPXOISA-N. The full InChI is InChI=1S/C18H15F6N/c1-11(13-6-4-3-5-7-13)25-12(2)14-8-15(17(19,20)21)10-16(9-14)18(22,23)24/h3-11H,1-2H3/b25-12+/t11-/m1/s1.
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1R)-1-phenylethyl]ethanimine?
1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1R)-1-phenylethyl]ethanimine has a molecular weight of 359.31 g/mol, XLogP of 6.29, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1R)-1-phenylethyl]ethanimine is sourced from PubChem (CID 24890559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).