C26H20N4O4S — CID 24890721
(5R)-5-[4-(1,3-benzothiazol-2-yl)phenyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 24890721) has the molecular formula C26H20N4O4S and a molecular weight of 484.54 g/mol. Its IUPAC name is (5R)-5-[4-(1,3-benzothiazol-2-yl)phenyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[4-(1,3-benzothiazol-2-yl)phenyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24890721 |
| Molecular Formula | C26H20N4O4S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | (5R)-5-[4-(1,3-benzothiazol-2-yl)phenyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(c3ccc(-c4nc5ccccc5s4)cc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C26H20N4O4S/c1-34-18-11-8-16-13-30(23(31)19(16)12-18)14-26(24(32)28-25(33)29-26)17-9-6-15(7-10-17)22-27-20-4-2-3-5-21(20)35-22/h2-12H,13-14H2,1H3,(H2,28,29,32,33)/t26-/m0/s1 |
| InChIKey | VOOKFNLTKTVFRG-SANMLTNESA-N |
| XLogP | 3.66 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|