C27H27F3N4O2 — CID 24890864
(E)-1-(3,4-difluorophenyl)-N-(2-fluoroethoxy)-1-[5-(1-spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-ylethyl)-2-pyridinyl]methanimine (PubChem CID 24890864) has the molecular formula C27H27F3N4O2 and a molecular weight of 496.53 g/mol. Its IUPAC name is (E)-1-(3,4-difluorophenyl)-N-(2-fluoroethoxy)-1-[5-(1-spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-ylethyl)-2-pyridinyl]methanimine.
| Compound Name | (E)-1-(3,4-difluorophenyl)-N-(2-fluoroethoxy)-1-[5-(1-spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-ylethyl)-2-pyridinyl]methanimine |
|---|---|
| PubChem CID | 24890864 |
| Molecular Formula | C27H27F3N4O2 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | (E)-1-(3,4-difluorophenyl)-N-(2-fluoroethoxy)-1-[5-(1-spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-ylethyl)-2-pyridinyl]methanimine |
| SMILES | CC(c1ccc(/C(=N/OCCF)c2ccc(F)c(F)c2)nc1)N1CCC2(CC1)OCc1ccncc12 |
| InChI | InChI=1S/C27H27F3N4O2/c1-18(34-11-7-27(8-12-34)22-16-31-10-6-21(22)17-35-27)20-3-5-25(32-15-20)26(33-36-13-9-28)19-2-4-23(29)24(30)14-19/h2-6,10,14-16,18H,7-9,11-13,17H2,1H3/b33-26+ |
| InChIKey | CULQTBGLEYVDTH-MHTZHOPKSA-N |
| XLogP | 5.08 |
| TPSA | 59.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|