C27H36N8O — CID 24891243
3-[4-[[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]phenyl]-N-(3-piperidin-1-ylpropyl)propanamide (PubChem CID 24891243) has the molecular formula C27H36N8O and a molecular weight of 488.64 g/mol. Its IUPAC name is 3-[4-[[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]phenyl]-N-(3-piperidin-1-ylpropyl)propanamide.
| Compound Name | 3-[4-[[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]phenyl]-N-(3-piperidin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 24891243 |
| Molecular Formula | C27H36N8O |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | 3-[4-[[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]phenyl]-N-(3-piperidin-1-ylpropyl)propanamide |
| SMILES | O=C(CCc1ccc(Nc2nccc(Nc3cc(C4CC4)[nH]n3)n2)cc1)NCCCN1CCCCC1 |
| InChI | InChI=1S/C27H36N8O/c36-26(28-14-4-18-35-16-2-1-3-17-35)12-7-20-5-10-22(11-6-20)30-27-29-15-13-24(32-27)31-25-19-23(33-34-25)21-8-9-21/h5-6,10-11,13,15,19,21H,1-4,7-9,12,14,16-18H2,(H,28,36)(H3,29,30,31,32,33,34) |
| InChIKey | NFNIHGWEBWHFOS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|