C25H27F3N4O4 — CID 24891557
(E)-N-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]-3-[(3R)-3-methyl-2,3,4,5-tetrahydro-1H-pyrido[2,3-e][1,4]diazepin-7-yl]prop-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 24891557) has the molecular formula C25H27F3N4O4 and a molecular weight of 504.51 g/mol. Its IUPAC name is (E)-N-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]-3-[(3R)-3-methyl-2,3,4,5-tetrahydro-1H-pyrido[2,3-e][1,4]diazepin-7-yl]prop-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | (E)-N-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]-3-[(3R)-3-methyl-2,3,4,5-tetrahydro-1H-pyrido[2,3-e][1,4]diazepin-7-yl]prop-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24891557 |
| Molecular Formula | C25H27F3N4O4 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | (E)-N-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]-3-[(3R)-3-methyl-2,3,4,5-tetrahydro-1H-pyrido[2,3-e][1,4]diazepin-7-yl]prop-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1c(CN(C)C(=O)/C=C/c2cnc3c(c2)CN[C@H](C)CN3)oc2ccccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H26N4O2.C2HF3O2/c1-15-11-25-23-18(13-24-15)10-17(12-26-23)8-9-22(28)27(3)14-21-16(2)19-6-4-5-7-20(19)29-21;3-2(4,5)1(6)7/h4-10,12,15,24H,11,13-14H2,1-3H3,(H,25,26);(H,6,7)/b9-8+;/t15-;/m1./s1 |
| InChIKey | AOVIKGVBACAFRB-VWUNKNEVSA-N |
| XLogP | 4.34 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|