About tert-butyl (2S)-2-[[5-(piperazin-4-ium-1-carbonyl)-1H-imidazole-4-carbonyl]amino]propanoate chloride
tert-butyl (2S)-2-[[5-(piperazin-4-ium-1-carbonyl)-1H-imidazole-4-carbonyl]amino]propanoate chloride (PubChem CID 24891750) has the molecular formula C16H26ClN5O4
and a molecular weight of 387.87 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[5-(piperazin-4-ium-1-carbonyl)-1H-imidazole-4-carbonyl]amino]propanoate chloride.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-[[5-(piperazin-4-ium-1-carbonyl)-1H-imidazole-4-carbonyl]amino]propanoate chloride |
| PubChem CID | 24891750 |
| Molecular Formula | C16H26ClN5O4 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | tert-butyl (2S)-2-[[5-(piperazin-4-ium-1-carbonyl)-1H-imidazole-4-carbonyl]amino]propanoate chloride |
| SMILES | C[C@H](NC(=O)c1nc[nH]c1C(=O)N1CC[NH2+]CC1)C(=O)OC(C)(C)C.[Cl-] |
| InChI | InChI=1S/C16H25N5O4.ClH/c1-10(15(24)25-16(2,3)4)20-13(22)11-12(19-9-18-11)14(23)21-7-5-17-6-8-21;/h9-10,17H,5-8H2,1-4H3,(H,18,19)(H,20,22);1H/t10-;/m0./s1 |
| InChIKey | YAWWTJWPAAXVGE-PPHPATTJSA-N |
| XLogP | -4.11 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl (2S)-2-[[5-(piperazin-4-ium-1-carbonyl)-1H-imidazole-4-carbonyl]amino]propanoate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-[[5-(piperazin-4-ium-1-carbonyl)-1H-imidazole-4-carbonyl]amino]propanoate chloride?
The IUPAC name of tert-butyl (2S)-2-[[5-(piperazin-4-ium-1-carbonyl)-1H-imidazole-4-carbonyl]amino]propanoate chloride (CID 24891750) is tert-butyl (2S)-2-[[5-(piperazin-4-ium-1-carbonyl)-1H-imidazole-4-carbonyl]amino]propanoate chloride.
What is the SMILES notation for tert-butyl (2S)-2-[[5-(piperazin-4-ium-1-carbonyl)-1H-imidazole-4-carbonyl]amino]propanoate chloride?
The canonical SMILES for tert-butyl (2S)-2-[[5-(piperazin-4-ium-1-carbonyl)-1H-imidazole-4-carbonyl]amino]propanoate chloride is C[C@H](NC(=O)c1nc[nH]c1C(=O)N1CC[NH2+]CC1)C(=O)OC(C)(C)C.[Cl-].
What is the InChIKey of tert-butyl (2S)-2-[[5-(piperazin-4-ium-1-carbonyl)-1H-imidazole-4-carbonyl]amino]propanoate chloride?
The InChIKey is YAWWTJWPAAXVGE-PPHPATTJSA-N. The full InChI is InChI=1S/C16H25N5O4.ClH/c1-10(15(24)25-16(2,3)4)20-13(22)11-12(19-9-18-11)14(23)21-7-5-17-6-8-21;/h9-10,17H,5-8H2,1-4H3,(H,18,19)(H,20,22);1H/t10-;/m0./s1.
What are the key properties of tert-butyl (2S)-2-[[5-(piperazin-4-ium-1-carbonyl)-1H-imidazole-4-carbonyl]amino]propanoate chloride?
tert-butyl (2S)-2-[[5-(piperazin-4-ium-1-carbonyl)-1H-imidazole-4-carbonyl]amino]propanoate chloride has a molecular weight of 387.87 g/mol, XLogP of -4.11, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-[[5-(piperazin-4-ium-1-carbonyl)-1H-imidazole-4-carbonyl]amino]propanoate chloride is sourced from PubChem (CID 24891750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).