C25H30F3N3O2S — CID 24891762
N-butyl-2-(4-cyclohexylsulfanylphenyl)imidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 24891762) has the molecular formula C25H30F3N3O2S and a molecular weight of 493.60 g/mol. Its IUPAC name is N-butyl-2-(4-cyclohexylsulfanylphenyl)imidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-butyl-2-(4-cyclohexylsulfanylphenyl)imidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24891762 |
| Molecular Formula | C25H30F3N3O2S |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | N-butyl-2-(4-cyclohexylsulfanylphenyl)imidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNc1c(-c2ccc(SC3CCCCC3)cc2)nc2ccccn12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H29N3S.C2HF3O2/c1-2-3-16-24-23-22(25-21-11-7-8-17-26(21)23)18-12-14-20(15-13-18)27-19-9-5-4-6-10-19;3-2(4,5)1(6)7/h7-8,11-15,17,19,24H,2-6,9-10,16H2,1H3;(H,6,7) |
| InChIKey | LCSJTGWWEOSOCZ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|