C25H32F3N3O2S — CID 24891764
N-butyl-2-(4-hexylsulfanylphenyl)imidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 24891764) has the molecular formula C25H32F3N3O2S and a molecular weight of 495.61 g/mol. Its IUPAC name is N-butyl-2-(4-hexylsulfanylphenyl)imidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-butyl-2-(4-hexylsulfanylphenyl)imidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24891764 |
| Molecular Formula | C25H32F3N3O2S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | N-butyl-2-(4-hexylsulfanylphenyl)imidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCSc1ccc(-c2nc3ccccn3c2NCCCC)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H31N3S.C2HF3O2/c1-3-5-7-10-18-27-20-14-12-19(13-15-20)22-23(24-16-6-4-2)26-17-9-8-11-21(26)25-22;3-2(4,5)1(6)7/h8-9,11-15,17,24H,3-7,10,16,18H2,1-2H3;(H,6,7) |
| InChIKey | ZCVJIVXKVUTLEH-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|