C27H34F3N3O3S — CID 24891774
N-butyl-2-(3-cyclohexylsulfanyl-4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 24891774) has the molecular formula C27H34F3N3O3S and a molecular weight of 537.65 g/mol. Its IUPAC name is N-butyl-2-(3-cyclohexylsulfanyl-4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-butyl-2-(3-cyclohexylsulfanyl-4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24891774 |
| Molecular Formula | C27H34F3N3O3S |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | N-butyl-2-(3-cyclohexylsulfanyl-4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNc1c(-c2ccc(OC)c(SC3CCCCC3)c2)nc2cc(C)ccn12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H33N3OS.C2HF3O2/c1-4-5-14-26-25-24(27-23-16-18(2)13-15-28(23)25)19-11-12-21(29-3)22(17-19)30-20-9-7-6-8-10-20;3-2(4,5)1(6)7/h11-13,15-17,20,26H,4-10,14H2,1-3H3;(H,6,7) |
| InChIKey | APUSVHDPXSJRQJ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|