C27H36F3N3O3S — CID 24891778
N-butyl-2-(3-hexylsulfanyl-4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 24891778) has the molecular formula C27H36F3N3O3S and a molecular weight of 539.66 g/mol. Its IUPAC name is N-butyl-2-(3-hexylsulfanyl-4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-butyl-2-(3-hexylsulfanyl-4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24891778 |
| Molecular Formula | C27H36F3N3O3S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | N-butyl-2-(3-hexylsulfanyl-4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCSc1cc(-c2nc3cc(C)ccn3c2NCCCC)ccc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H35N3OS.C2HF3O2/c1-5-7-9-10-16-30-22-18-20(11-12-21(22)29-4)24-25(26-14-8-6-2)28-15-13-19(3)17-23(28)27-24;3-2(4,5)1(6)7/h11-13,15,17-18,26H,5-10,14,16H2,1-4H3;(H,6,7) |
| InChIKey | RTRJSGNYMZTHQA-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|