C27H27F3N4O4 — CID 24891822
1-[4-[4-[3-(butylamino)imidazo[1,2-a]pyrazin-2-yl]-2-methoxyphenyl]phenyl]ethanone;2,2,2-trifluoroacetic acid (PubChem CID 24891822) has the molecular formula C27H27F3N4O4 and a molecular weight of 528.53 g/mol. Its IUPAC name is 1-[4-[4-[3-(butylamino)imidazo[1,2-a]pyrazin-2-yl]-2-methoxyphenyl]phenyl]ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[4-[4-[3-(butylamino)imidazo[1,2-a]pyrazin-2-yl]-2-methoxyphenyl]phenyl]ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24891822 |
| Molecular Formula | C27H27F3N4O4 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 1-[4-[4-[3-(butylamino)imidazo[1,2-a]pyrazin-2-yl]-2-methoxyphenyl]phenyl]ethanone;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNc1c(-c2ccc(-c3ccc(C(C)=O)cc3)c(OC)c2)nc2cnccn12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H26N4O2.C2HF3O2/c1-4-5-12-27-25-24(28-23-16-26-13-14-29(23)25)20-10-11-21(22(15-20)31-3)19-8-6-18(7-9-19)17(2)30;3-2(4,5)1(6)7/h6-11,13-16,27H,4-5,12H2,1-3H3;(H,6,7) |
| InChIKey | LXTXDLFDBJNPCC-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|