C33H28ClNO6 — CID 24892253
propyl 4-(2,4,6-triphenylpyridin-1-ium-1-yl)benzoate perchlorate (PubChem CID 24892253) has the molecular formula C33H28ClNO6 and a molecular weight of 570.04 g/mol. Its IUPAC name is propyl 4-(2,4,6-triphenylpyridin-1-ium-1-yl)benzoate perchlorate.
| Compound Name | propyl 4-(2,4,6-triphenylpyridin-1-ium-1-yl)benzoate perchlorate |
|---|---|
| PubChem CID | 24892253 |
| Molecular Formula | C33H28ClNO6 |
| Molecular Weight | 570.04 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | propyl 4-(2,4,6-triphenylpyridin-1-ium-1-yl)benzoate perchlorate |
| SMILES | CCCOC(=O)c1ccc(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C33H28NO2.ClHO4/c1-2-22-36-33(35)28-18-20-30(21-19-28)34-31(26-14-8-4-9-15-26)23-29(25-12-6-3-7-13-25)24-32(34)27-16-10-5-11-17-27;2-1(3,4)5/h3-21,23-24H,2,22H2,1H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | ZZMKCJVCLDCKCI-UHFFFAOYSA-M |
| XLogP | 2.78 |
| TPSA | 122.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.04 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|