C25H25F3N2O6 — CID 24892276
methyl (1S,3R,3aS,6aR)-5-ethyl-3-methyl-4,6-dioxo-1-(4-phenylphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 24892276) has the molecular formula C25H25F3N2O6 and a molecular weight of 506.48 g/mol. Its IUPAC name is methyl (1S,3R,3aS,6aR)-5-ethyl-3-methyl-4,6-dioxo-1-(4-phenylphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (1S,3R,3aS,6aR)-5-ethyl-3-methyl-4,6-dioxo-1-(4-phenylphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24892276 |
| Molecular Formula | C25H25F3N2O6 |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | methyl (1S,3R,3aS,6aR)-5-ethyl-3-methyl-4,6-dioxo-1-(4-phenylphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCN1C(=O)[C@H]2[C@@H](c3ccc(-c4ccccc4)cc3)N[C@@](C)(C(=O)OC)[C@H]2C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H24N2O4.C2HF3O2/c1-4-25-20(26)17-18(21(25)27)23(2,22(28)29-3)24-19(17)16-12-10-15(11-13-16)14-8-6-5-7-9-14;3-2(4,5)1(6)7/h5-13,17-19,24H,4H2,1-3H3;(H,6,7)/t17-,18-,19-,23-;/m1./s1 |
| InChIKey | AVVBPDIPVNIIMY-PLRMZIDKSA-N |
| XLogP | 3.18 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|