C26H25Cl2F3N2O7 — CID 24892315
methyl (1S,3R,3aS,6aR)-1-[4-(3,4-dichlorophenyl)-3-methoxyphenyl]-5-ethyl-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 24892315) has the molecular formula C26H25Cl2F3N2O7 and a molecular weight of 605.39 g/mol. Its IUPAC name is methyl (1S,3R,3aS,6aR)-1-[4-(3,4-dichlorophenyl)-3-methoxyphenyl]-5-ethyl-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (1S,3R,3aS,6aR)-1-[4-(3,4-dichlorophenyl)-3-methoxyphenyl]-5-ethyl-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24892315 |
| Molecular Formula | C26H25Cl2F3N2O7 |
| Molecular Weight | 605.39 g/mol |
| Exact Mass | 604.10 |
| IUPAC Name | methyl (1S,3R,3aS,6aR)-1-[4-(3,4-dichlorophenyl)-3-methoxyphenyl]-5-ethyl-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCN1C(=O)[C@H]2[C@@H](c3ccc(-c4ccc(Cl)c(Cl)c4)c(OC)c3)N[C@@](C)(C(=O)OC)[C@H]2C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H24Cl2N2O5.C2HF3O2/c1-5-28-21(29)18-19(22(28)30)24(2,23(31)33-4)27-20(18)13-6-8-14(17(11-13)32-3)12-7-9-15(25)16(26)10-12;3-2(4,5)1(6)7/h6-11,18-20,27H,5H2,1-4H3;(H,6,7)/t18-,19-,20-,24-;/m1./s1 |
| InChIKey | BYAWEZSVKXBNIS-WRCDMPKQSA-N |
| XLogP | 4.50 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|