C24H21Cl2F3N2O6 — CID 24892319
methyl (1S,3R,3aS,6aR)-1-[4-(3,4-dichlorophenyl)phenyl]-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 24892319) has the molecular formula C24H21Cl2F3N2O6 and a molecular weight of 561.34 g/mol. Its IUPAC name is methyl (1S,3R,3aS,6aR)-1-[4-(3,4-dichlorophenyl)phenyl]-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (1S,3R,3aS,6aR)-1-[4-(3,4-dichlorophenyl)phenyl]-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24892319 |
| Molecular Formula | C24H21Cl2F3N2O6 |
| Molecular Weight | 561.34 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | methyl (1S,3R,3aS,6aR)-1-[4-(3,4-dichlorophenyl)phenyl]-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)[C@]1(C)N[C@H](c2ccc(-c3ccc(Cl)c(Cl)c3)cc2)[C@@H]2C(=O)N(C)C(=O)[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H20Cl2N2O4.C2HF3O2/c1-22(21(29)30-3)17-16(19(27)26(2)20(17)28)18(25-22)12-6-4-11(5-7-12)13-8-9-14(23)15(24)10-13;3-2(4,5)1(6)7/h4-10,16-18,25H,1-3H3;(H,6,7)/t16-,17-,18-,22-;/m1./s1 |
| InChIKey | JHJRLGZRAWGHTE-IFLGGYHBSA-N |
| XLogP | 4.10 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|