C28H39F3N2O7S — CID 24892331
methyl (1S,3R,3aS,6aR)-1-(4-hexylsulfanyl-3-methoxyphenyl)-5-methyl-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 24892331) has the molecular formula C28H39F3N2O7S and a molecular weight of 604.69 g/mol. Its IUPAC name is methyl (1S,3R,3aS,6aR)-1-(4-hexylsulfanyl-3-methoxyphenyl)-5-methyl-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (1S,3R,3aS,6aR)-1-(4-hexylsulfanyl-3-methoxyphenyl)-5-methyl-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24892331 |
| Molecular Formula | C28H39F3N2O7S |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | methyl (1S,3R,3aS,6aR)-1-(4-hexylsulfanyl-3-methoxyphenyl)-5-methyl-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCSc1ccc([C@H]2N[C@@](CC(C)C)(C(=O)OC)[C@H]3C(=O)N(C)C(=O)[C@@H]23)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H38N2O5S.C2HF3O2/c1-7-8-9-10-13-34-19-12-11-17(14-18(19)32-5)22-20-21(24(30)28(4)23(20)29)26(27-22,15-16(2)3)25(31)33-6;3-2(4,5)1(6)7/h11-12,14,16,20-22,27H,7-10,13,15H2,1-6H3;(H,6,7)/t20-,21-,22-,26-;/m1./s1 |
| InChIKey | ZPIWKWTZOWXKJC-PLRPEPICSA-N |
| XLogP | 4.83 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|