C24H29F3N2O6S — CID 24892335
methyl (1S,3R,3aS,6aR)-1-(4-cyclohexylsulfanylphenyl)-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 24892335) has the molecular formula C24H29F3N2O6S and a molecular weight of 530.57 g/mol. Its IUPAC name is methyl (1S,3R,3aS,6aR)-1-(4-cyclohexylsulfanylphenyl)-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (1S,3R,3aS,6aR)-1-(4-cyclohexylsulfanylphenyl)-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24892335 |
| Molecular Formula | C24H29F3N2O6S |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | methyl (1S,3R,3aS,6aR)-1-(4-cyclohexylsulfanylphenyl)-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)[C@]1(C)N[C@H](c2ccc(SC3CCCCC3)cc2)[C@@H]2C(=O)N(C)C(=O)[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H28N2O4S.C2HF3O2/c1-22(21(27)28-3)17-16(19(25)24(2)20(17)26)18(23-22)13-9-11-15(12-10-13)29-14-7-5-4-6-8-14;3-2(4,5)1(6)7/h9-12,14,16-18,23H,4-8H2,1-3H3;(H,6,7)/t16-,17-,18-,22-;/m1./s1 |
| InChIKey | SGVXUMYTAAQPKV-IFLGGYHBSA-N |
| XLogP | 3.55 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|