C31H37F3N2O6S — CID 24892341
methyl (1S,3R,3aS,6aR)-3-benzyl-5-ethyl-1-(4-hexylsulfanylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 24892341) has the molecular formula C31H37F3N2O6S and a molecular weight of 622.71 g/mol. Its IUPAC name is methyl (1S,3R,3aS,6aR)-3-benzyl-5-ethyl-1-(4-hexylsulfanylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (1S,3R,3aS,6aR)-3-benzyl-5-ethyl-1-(4-hexylsulfanylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24892341 |
| Molecular Formula | C31H37F3N2O6S |
| Molecular Weight | 622.71 g/mol |
| Exact Mass | 622.23 |
| IUPAC Name | methyl (1S,3R,3aS,6aR)-3-benzyl-5-ethyl-1-(4-hexylsulfanylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCSc1ccc([C@H]2N[C@@](Cc3ccccc3)(C(=O)OC)[C@H]3C(=O)N(CC)C(=O)[C@@H]23)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H36N2O4S.C2HF3O2/c1-4-6-7-11-18-36-22-16-14-21(15-17-22)25-23-24(27(33)31(5-2)26(23)32)29(30-25,28(34)35-3)19-20-12-9-8-10-13-20;3-2(4,5)1(6)7/h8-10,12-17,23-25,30H,4-7,11,18-19H2,1-3H3;(H,6,7)/t23-,24-,25-,29-;/m1./s1 |
| InChIKey | KNTCHRZKRZFHCF-OANXMZBQSA-N |
| XLogP | 5.41 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.71 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|