C25H32F3N3O3S — CID 24892470
2-(4-butan-2-ylsulfanyl-3-methoxyphenyl)-N-butyl-6-methylimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 24892470) has the molecular formula C25H32F3N3O3S and a molecular weight of 511.61 g/mol. Its IUPAC name is 2-(4-butan-2-ylsulfanyl-3-methoxyphenyl)-N-butyl-6-methylimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(4-butan-2-ylsulfanyl-3-methoxyphenyl)-N-butyl-6-methylimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24892470 |
| Molecular Formula | C25H32F3N3O3S |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 2-(4-butan-2-ylsulfanyl-3-methoxyphenyl)-N-butyl-6-methylimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNc1c(-c2ccc(SC(C)CC)c(OC)c2)nc2ccc(C)cn12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H31N3OS.C2HF3O2/c1-6-8-13-24-23-22(25-21-12-9-16(3)15-26(21)23)18-10-11-20(19(14-18)27-5)28-17(4)7-2;3-2(4,5)1(6)7/h9-12,14-15,17,24H,6-8,13H2,1-5H3;(H,6,7) |
| InChIKey | SVFQSGBEYBKLMW-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|