C24H28ClNO6 — CID 24892494
1-(2,2-diethoxyethyl)-4-methyl-2,6-diphenylpyridin-1-ium perchlorate (PubChem CID 24892494) has the molecular formula C24H28ClNO6 and a molecular weight of 461.94 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-4-methyl-2,6-diphenylpyridin-1-ium perchlorate.
| Compound Name | 1-(2,2-diethoxyethyl)-4-methyl-2,6-diphenylpyridin-1-ium perchlorate |
|---|---|
| PubChem CID | 24892494 |
| Molecular Formula | C24H28ClNO6 |
| Molecular Weight | 461.94 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-4-methyl-2,6-diphenylpyridin-1-ium perchlorate |
| SMILES | CCOC(C[n+]1c(-c2ccccc2)cc(C)cc1-c1ccccc1)OCC.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H28NO2.ClHO4/c1-4-26-24(27-5-2)18-25-22(20-12-8-6-9-13-20)16-19(3)17-23(25)21-14-10-7-11-15-21;2-1(3,4)5/h6-17,24H,4-5,18H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | XTFGOEXSYIRILF-UHFFFAOYSA-M |
| XLogP | 0.26 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.94 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|