About 5-[(3,4-dimethylpyridin-1-ium-1-yl)methyl]-2-methylpyrimidin-4-amine chloride
5-[(3,4-dimethylpyridin-1-ium-1-yl)methyl]-2-methylpyrimidin-4-amine chloride (PubChem CID 24892504) has the molecular formula C13H17ClN4
and a molecular weight of 264.76 g/mol. Its IUPAC name is 5-[(3,4-dimethylpyridin-1-ium-1-yl)methyl]-2-methylpyrimidin-4-amine chloride.
Molecular Properties
| Compound Name | 5-[(3,4-dimethylpyridin-1-ium-1-yl)methyl]-2-methylpyrimidin-4-amine chloride |
| PubChem CID | 24892504 |
| Molecular Formula | C13H17ClN4 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 5-[(3,4-dimethylpyridin-1-ium-1-yl)methyl]-2-methylpyrimidin-4-amine chloride |
| SMILES | Cc1ncc(C[n+]2ccc(C)c(C)c2)c(N)n1.[Cl-] |
| InChI | InChI=1S/C13H17N4.ClH/c1-9-4-5-17(7-10(9)2)8-12-6-15-11(3)16-13(12)14;/h4-7H,8H2,1-3H3,(H2,14,15,16);1H/q+1;/p-1 |
| InChIKey | XZXHBPQTCTVOAY-UHFFFAOYSA-M |
| XLogP | -1.68 |
| TPSA | 55.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3,4-dimethylpyridin-1-ium-1-yl)methyl]-2-methylpyrimidin-4-amine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,4-dimethylpyridin-1-ium-1-yl)methyl]-2-methylpyrimidin-4-amine chloride?
The IUPAC name of 5-[(3,4-dimethylpyridin-1-ium-1-yl)methyl]-2-methylpyrimidin-4-amine chloride (CID 24892504) is 5-[(3,4-dimethylpyridin-1-ium-1-yl)methyl]-2-methylpyrimidin-4-amine chloride.
What is the SMILES notation for 5-[(3,4-dimethylpyridin-1-ium-1-yl)methyl]-2-methylpyrimidin-4-amine chloride?
The canonical SMILES for 5-[(3,4-dimethylpyridin-1-ium-1-yl)methyl]-2-methylpyrimidin-4-amine chloride is Cc1ncc(C[n+]2ccc(C)c(C)c2)c(N)n1.[Cl-].
What is the InChIKey of 5-[(3,4-dimethylpyridin-1-ium-1-yl)methyl]-2-methylpyrimidin-4-amine chloride?
The InChIKey is XZXHBPQTCTVOAY-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H17N4.ClH/c1-9-4-5-17(7-10(9)2)8-12-6-15-11(3)16-13(12)14;/h4-7H,8H2,1-3H3,(H2,14,15,16);1H/q+1;/p-1.
What are the key properties of 5-[(3,4-dimethylpyridin-1-ium-1-yl)methyl]-2-methylpyrimidin-4-amine chloride?
5-[(3,4-dimethylpyridin-1-ium-1-yl)methyl]-2-methylpyrimidin-4-amine chloride has a molecular weight of 264.76 g/mol, XLogP of -1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-dimethylpyridin-1-ium-1-yl)methyl]-2-methylpyrimidin-4-amine chloride is sourced from PubChem (CID 24892504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).