C7H8N2OS — CID 24894152
2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine (PubChem CID 24894152) has the molecular formula C7H8N2OS and a molecular weight of 168.22 g/mol. Its IUPAC name is 2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine.
| Compound Name | 2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine |
|---|---|
| PubChem CID | 24894152 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine |
| SMILES | NC1=NCCOc2ccsc21 |
| InChI | InChI=1S/C7H8N2OS/c8-7-6-5(1-4-11-6)10-3-2-9-7/h1,4H,2-3H2,(H2,8,9) |
| InChIKey | NZHZTEBAKPIRJP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |